C18H25Cl2NO — CID 139682543
(4bR,8aS)-2,3-dichloro-4b-[2-(dimethylamino)ethyl]-5,6,7,8,9,10-hexahydrophenanthren-8a-ol (PubChem CID 139682543) has the molecular formula C18H25Cl2NO and a molecular weight of 342.31 g/mol. Its IUPAC name is (4bR,8aS)-2,3-dichloro-4b-[2-(dimethylamino)ethyl]-5,6,7,8,9,10-hexahydrophenanthren-8a-ol.
| Compound Name | (4bR,8aS)-2,3-dichloro-4b-[2-(dimethylamino)ethyl]-5,6,7,8,9,10-hexahydrophenanthren-8a-ol |
|---|---|
| PubChem CID | 139682543 |
| Molecular Formula | C18H25Cl2NO |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | (4bR,8aS)-2,3-dichloro-4b-[2-(dimethylamino)ethyl]-5,6,7,8,9,10-hexahydrophenanthren-8a-ol |
| SMILES | CN(C)CC[C@@]12CCCC[C@]1(O)CCc1cc(Cl)c(Cl)cc12 |
| InChI | InChI=1S/C18H25Cl2NO/c1-21(2)10-9-17-6-3-4-7-18(17,22)8-5-13-11-15(19)16(20)12-14(13)17/h11-12,22H,3-10H2,1-2H3/t17-,18+/m1/s1 |
| InChIKey | HUYWNRSIXWBDMD-MSOLQXFVSA-N |
| XLogP | 4.43 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |