C8H8O2 — CID 139683093
1-methoxybicyclo[3.2.0]hepta-3,5-dien-2-one (PubChem CID 139683093) has the molecular formula C8H8O2 and a molecular weight of 136.15 g/mol. Its IUPAC name is 1-methoxybicyclo[3.2.0]hepta-3,5-dien-2-one.
| Compound Name | 1-methoxybicyclo[3.2.0]hepta-3,5-dien-2-one |
|---|---|
| PubChem CID | 139683093 |
| Molecular Formula | C8H8O2 |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.05 |
| IUPAC Name | 1-methoxybicyclo[3.2.0]hepta-3,5-dien-2-one |
| SMILES | COC12CC=C1C=CC2=O |
| InChI | InChI=1S/C8H8O2/c1-10-8-5-4-6(8)2-3-7(8)9/h2-4H,5H2,1H3 |
| InChIKey | LTJBLXXOPNUNKD-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |