C8H12F6OS — CID 139683155
1,1,1,2,3,3-hexafluoro-3-(2-propan-2-ylsulfanylethoxy)propane (PubChem CID 139683155) has the molecular formula C8H12F6OS and a molecular weight of 270.24 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-3-(2-propan-2-ylsulfanylethoxy)propane.
| Compound Name | 1,1,1,2,3,3-hexafluoro-3-(2-propan-2-ylsulfanylethoxy)propane |
|---|---|
| PubChem CID | 139683155 |
| Molecular Formula | C8H12F6OS |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-3-(2-propan-2-ylsulfanylethoxy)propane |
| SMILES | CC(C)SCCOC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C8H12F6OS/c1-5(2)16-4-3-15-8(13,14)6(9)7(10,11)12/h5-6H,3-4H2,1-2H3 |
| InChIKey | GZBNTNHHEXCGTB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|