C7H10F6O2 — CID 139683264
1-(2-ethoxyethoxy)-1,1,2,3,3,3-hexafluoropropane (PubChem CID 139683264) has the molecular formula C7H10F6O2 and a molecular weight of 240.14 g/mol. Its IUPAC name is 1-(2-ethoxyethoxy)-1,1,2,3,3,3-hexafluoropropane.
| Compound Name | 1-(2-ethoxyethoxy)-1,1,2,3,3,3-hexafluoropropane |
|---|---|
| PubChem CID | 139683264 |
| Molecular Formula | C7H10F6O2 |
| Molecular Weight | 240.14 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 1-(2-ethoxyethoxy)-1,1,2,3,3,3-hexafluoropropane |
| SMILES | CCOCCOC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C7H10F6O2/c1-2-14-3-4-15-7(12,13)5(8)6(9,10)11/h5H,2-4H2,1H3 |
| InChIKey | OPSJHMXLHIBPJD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.14 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|