C33H38N4O8S — CID 139683901
2-[2-[[4-[2-(butoxycarbonylsulfamoyl)phenyl]phenyl]methyl]butanoylamino]-1-(pyridine-3-carbonyl)pyrrolidine-2-carboxylic acid (PubChem CID 139683901) has the molecular formula C33H38N4O8S and a molecular weight of 650.75 g/mol. Its IUPAC name is 2-[2-[[4-[2-(butoxycarbonylsulfamoyl)phenyl]phenyl]methyl]butanoylamino]-1-(pyridine-3-carbonyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 2-[2-[[4-[2-(butoxycarbonylsulfamoyl)phenyl]phenyl]methyl]butanoylamino]-1-(pyridine-3-carbonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 139683901 |
| Molecular Formula | C33H38N4O8S |
| Molecular Weight | 650.75 g/mol |
| Exact Mass | 650.24 |
| IUPAC Name | 2-[2-[[4-[2-(butoxycarbonylsulfamoyl)phenyl]phenyl]methyl]butanoylamino]-1-(pyridine-3-carbonyl)pyrrolidine-2-carboxylic acid |
| SMILES | CCCCOC(=O)NS(=O)(=O)c1ccccc1-c1ccc(CC(CC)C(=O)NC2(C(=O)O)CCCN2C(=O)c2cccnc2)cc1 |
| InChI | InChI=1S/C33H38N4O8S/c1-3-5-20-45-32(42)36-46(43,44)28-12-7-6-11-27(28)25-15-13-23(14-16-25)21-24(4-2)29(38)35-33(31(40)41)17-9-19-37(33)30(39)26-10-8-18-34-22-26/h6-8,10-16,18,22,24H,3-5,9,17,19-21H2,1-2H3,(H,35,38)(H,36,42)(H,40,41) |
| InChIKey | VPWZODIYTDLKQR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 172.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.75 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|