C23H28N2O7 — CID 139683926
methyl (2S,4S)-4-amino-1-[4-[3,5-bis(methoxymethoxy)phenyl]benzoyl]pyrrolidine-2-carboxylate (PubChem CID 139683926) has the molecular formula C23H28N2O7 and a molecular weight of 444.48 g/mol. Its IUPAC name is methyl (2S,4S)-4-amino-1-[4-[3,5-bis(methoxymethoxy)phenyl]benzoyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4S)-4-amino-1-[4-[3,5-bis(methoxymethoxy)phenyl]benzoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 139683926 |
| Molecular Formula | C23H28N2O7 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | methyl (2S,4S)-4-amino-1-[4-[3,5-bis(methoxymethoxy)phenyl]benzoyl]pyrrolidine-2-carboxylate |
| SMILES | COCOc1cc(OCOC)cc(-c2ccc(C(=O)N3C[C@@H](N)C[C@H]3C(=O)OC)cc2)c1 |
| InChI | InChI=1S/C23H28N2O7/c1-28-13-31-19-8-17(9-20(11-19)32-14-29-2)15-4-6-16(7-5-15)22(26)25-12-18(24)10-21(25)23(27)30-3/h4-9,11,18,21H,10,12-14,24H2,1-3H3/t18-,21-/m0/s1 |
| InChIKey | LIJZOPILPSOMQB-RXVVDRJESA-N |
| XLogP | 2.03 |
| TPSA | 109.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|