C12H13N5O3 — CID 139684114
methyl (2S,4S)-4-azido-1-(pyridine-4-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 139684114) has the molecular formula C12H13N5O3 and a molecular weight of 275.27 g/mol. Its IUPAC name is methyl (2S,4S)-4-azido-1-(pyridine-4-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4S)-4-azido-1-(pyridine-4-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 139684114 |
| Molecular Formula | C12H13N5O3 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | methyl (2S,4S)-4-azido-1-(pyridine-4-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](N=[N+]=[N-])CN1C(=O)c1ccncc1 |
| InChI | InChI=1S/C12H13N5O3/c1-20-12(19)10-6-9(15-16-13)7-17(10)11(18)8-2-4-14-5-3-8/h2-5,9-10H,6-7H2,1H3/t9-,10-/m0/s1 |
| InChIKey | PQPVNKUUIXHMAU-UWVGGRQHSA-N |
| XLogP | 1.15 |
| TPSA | 108.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|