C29H39N3O3 — CID 139684191
N-[2-tert-butyl-5-(pyrazol-1-ylmethyl)phenyl]-3-(2-hydroxy-3-methoxyphenyl)octanamide (PubChem CID 139684191) has the molecular formula C29H39N3O3 and a molecular weight of 477.65 g/mol. Its IUPAC name is N-[2-tert-butyl-5-(pyrazol-1-ylmethyl)phenyl]-3-(2-hydroxy-3-methoxyphenyl)octanamide.
| Compound Name | N-[2-tert-butyl-5-(pyrazol-1-ylmethyl)phenyl]-3-(2-hydroxy-3-methoxyphenyl)octanamide |
|---|---|
| PubChem CID | 139684191 |
| Molecular Formula | C29H39N3O3 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.30 |
| IUPAC Name | N-[2-tert-butyl-5-(pyrazol-1-ylmethyl)phenyl]-3-(2-hydroxy-3-methoxyphenyl)octanamide |
| SMILES | CCCCCC(CC(=O)Nc1cc(Cn2cccn2)ccc1C(C)(C)C)c1cccc(OC)c1O |
| InChI | InChI=1S/C29H39N3O3/c1-6-7-8-11-22(23-12-9-13-26(35-5)28(23)34)19-27(33)31-25-18-21(20-32-17-10-16-30-32)14-15-24(25)29(2,3)4/h9-10,12-18,22,34H,6-8,11,19-20H2,1-5H3,(H,31,33) |
| InChIKey | JPXZGZQVALRUEL-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|