C31H43N3O4 — CID 139684200
N-[2-tert-butyl-5-(pyrazol-1-ylmethyl)phenyl]-3-(2,3,4-trimethoxyphenyl)octanamide (PubChem CID 139684200) has the molecular formula C31H43N3O4 and a molecular weight of 521.70 g/mol. Its IUPAC name is N-[2-tert-butyl-5-(pyrazol-1-ylmethyl)phenyl]-3-(2,3,4-trimethoxyphenyl)octanamide.
| Compound Name | N-[2-tert-butyl-5-(pyrazol-1-ylmethyl)phenyl]-3-(2,3,4-trimethoxyphenyl)octanamide |
|---|---|
| PubChem CID | 139684200 |
| Molecular Formula | C31H43N3O4 |
| Molecular Weight | 521.70 g/mol |
| Exact Mass | 521.33 |
| IUPAC Name | N-[2-tert-butyl-5-(pyrazol-1-ylmethyl)phenyl]-3-(2,3,4-trimethoxyphenyl)octanamide |
| SMILES | CCCCCC(CC(=O)Nc1cc(Cn2cccn2)ccc1C(C)(C)C)c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C31H43N3O4/c1-8-9-10-12-23(24-14-16-27(36-5)30(38-7)29(24)37-6)20-28(35)33-26-19-22(21-34-18-11-17-32-34)13-15-25(26)31(2,3)4/h11,13-19,23H,8-10,12,20-21H2,1-7H3,(H,33,35) |
| InChIKey | BMFGCUXLPYOWQL-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.70 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|