C31H40N4O4 — CID 139684801
2-amino-N-[(3R,4R)-1-[5-(dimethylamino)-5-oxo-4,4-diphenylpentan-2-yl]-3-hydroxypiperidin-4-yl]benzamide;hydrate (PubChem CID 139684801) has the molecular formula C31H40N4O4 and a molecular weight of 532.69 g/mol. Its IUPAC name is 2-amino-N-[(3R,4R)-1-[5-(dimethylamino)-5-oxo-4,4-diphenylpentan-2-yl]-3-hydroxypiperidin-4-yl]benzamide;hydrate.
| Compound Name | 2-amino-N-[(3R,4R)-1-[5-(dimethylamino)-5-oxo-4,4-diphenylpentan-2-yl]-3-hydroxypiperidin-4-yl]benzamide;hydrate |
|---|---|
| PubChem CID | 139684801 |
| Molecular Formula | C31H40N4O4 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | 2-amino-N-[(3R,4R)-1-[5-(dimethylamino)-5-oxo-4,4-diphenylpentan-2-yl]-3-hydroxypiperidin-4-yl]benzamide;hydrate |
| SMILES | CC(CC(C(=O)N(C)C)(c1ccccc1)c1ccccc1)N1CC[C@@H](NC(=O)c2ccccc2N)[C@H](O)C1.O |
| InChI | InChI=1S/C31H38N4O3.H2O/c1-22(35-19-18-27(28(36)21-35)33-29(37)25-16-10-11-17-26(25)32)20-31(30(38)34(2)3,23-12-6-4-7-13-23)24-14-8-5-9-15-24;/h4-17,22,27-28,36H,18-21,32H2,1-3H3,(H,33,37);1H2/t22?,27-,28-;/m1./s1 |
| InChIKey | YSEBUAKSJAOSII-MTYHNPJZSA-N |
| XLogP | 2.46 |
| TPSA | 130.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|