C9H4F13NO — CID 139685059
2,2,3,5,5,5-hexafluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxymethyl)pentanenitrile (PubChem CID 139685059) has the molecular formula C9H4F13NO and a molecular weight of 389.11 g/mol. Its IUPAC name is 2,2,3,5,5,5-hexafluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxymethyl)pentanenitrile.
| Compound Name | 2,2,3,5,5,5-hexafluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxymethyl)pentanenitrile |
|---|---|
| PubChem CID | 139685059 |
| Molecular Formula | C9H4F13NO |
| Molecular Weight | 389.11 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | 2,2,3,5,5,5-hexafluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxymethyl)pentanenitrile |
| SMILES | N#CC(F)(F)C(F)C(COC(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H4F13NO/c10-4(5(11,12)2-23)3(6(13,14)15)1-24-7(16,8(17,18)19)9(20,21)22/h3-4H,1H2 |
| InChIKey | RWUQTTYDEGAFGZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.11 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |