C6H4F7NO — CID 139685061
3-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)propanenitrile (PubChem CID 139685061) has the molecular formula C6H4F7NO and a molecular weight of 239.09 g/mol. Its IUPAC name is 3-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)propanenitrile.
| Compound Name | 3-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)propanenitrile |
|---|---|
| PubChem CID | 139685061 |
| Molecular Formula | C6H4F7NO |
| Molecular Weight | 239.09 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | 3-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)propanenitrile |
| SMILES | N#CCCOC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H4F7NO/c7-4(5(8,9)10,6(11,12)13)15-3-1-2-14/h1,3H2 |
| InChIKey | JAONGCOCQMTVJS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.09 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|