About diphenyl-(2,3,4-trimethylphenyl)methanol
diphenyl-(2,3,4-trimethylphenyl)methanol (PubChem CID 139685459) has the molecular formula C22H22O
and a molecular weight of 302.42 g/mol. Its IUPAC name is diphenyl-(2,3,4-trimethylphenyl)methanol.
Molecular Properties
| Compound Name | diphenyl-(2,3,4-trimethylphenyl)methanol |
| PubChem CID | 139685459 |
| Molecular Formula | C22H22O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | diphenyl-(2,3,4-trimethylphenyl)methanol |
| SMILES | Cc1ccc(C(O)(c2ccccc2)c2ccccc2)c(C)c1C |
| InChI | InChI=1S/C22H22O/c1-16-14-15-21(18(3)17(16)2)22(23,19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-15,23H,1-3H3 |
| InChIKey | SUGODPOGARSZMU-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze diphenyl-(2,3,4-trimethylphenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl-(2,3,4-trimethylphenyl)methanol?
The IUPAC name of diphenyl-(2,3,4-trimethylphenyl)methanol (CID 139685459) is diphenyl-(2,3,4-trimethylphenyl)methanol.
What is the SMILES notation for diphenyl-(2,3,4-trimethylphenyl)methanol?
The canonical SMILES for diphenyl-(2,3,4-trimethylphenyl)methanol is Cc1ccc(C(O)(c2ccccc2)c2ccccc2)c(C)c1C.
What is the InChIKey of diphenyl-(2,3,4-trimethylphenyl)methanol?
The InChIKey is SUGODPOGARSZMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22O/c1-16-14-15-21(18(3)17(16)2)22(23,19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-15,23H,1-3H3.
What are the key properties of diphenyl-(2,3,4-trimethylphenyl)methanol?
diphenyl-(2,3,4-trimethylphenyl)methanol has a molecular weight of 302.42 g/mol, XLogP of 4.90, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl-(2,3,4-trimethylphenyl)methanol is sourced from PubChem (CID 139685459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).