C25H28N2O6S — CID 139687657
2-[(1S,15R,20S)-19-methylsulfonyl-5,7-dioxa-13,19-diazapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-trien-3-yl]benzoic acid (PubChem CID 139687657) has the molecular formula C25H28N2O6S and a molecular weight of 484.57 g/mol. Its IUPAC name is 2-[(1S,15R,20S)-19-methylsulfonyl-5,7-dioxa-13,19-diazapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-trien-3-yl]benzoic acid.
| Compound Name | 2-[(1S,15R,20S)-19-methylsulfonyl-5,7-dioxa-13,19-diazapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-trien-3-yl]benzoic acid |
|---|---|
| PubChem CID | 139687657 |
| Molecular Formula | C25H28N2O6S |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 2-[(1S,15R,20S)-19-methylsulfonyl-5,7-dioxa-13,19-diazapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9-trien-3-yl]benzoic acid |
| SMILES | CS(=O)(=O)N1CCC[C@@H]2CN3CCc4cc5c(c(-c6ccccc6C(=O)O)c4[C@@H]3C[C@@H]21)OCO5 |
| InChI | InChI=1S/C25H28N2O6S/c1-34(30,31)27-9-4-5-16-13-26-10-8-15-11-21-24(33-14-32-21)23(22(15)20(26)12-19(16)27)17-6-2-3-7-18(17)25(28)29/h2-3,6-7,11,16,19-20H,4-5,8-10,12-14H2,1H3,(H,28,29)/t16-,19+,20+/m1/s1 |
| InChIKey | GFASHKYLNBJRAJ-UXPWSPDFSA-N |
| XLogP | 3.12 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |