About 1,6-dimethyl-4-N-(4-methylsulfanylphenyl)pyridin-1-ium-2,4-diamine iodide
1,6-dimethyl-4-N-(4-methylsulfanylphenyl)pyridin-1-ium-2,4-diamine iodide (PubChem CID 139687678) has the molecular formula C14H18IN3S
and a molecular weight of 387.29 g/mol. Its IUPAC name is 1,6-dimethyl-4-N-(4-methylsulfanylphenyl)pyridin-1-ium-2,4-diamine iodide.
Molecular Properties
| Compound Name | 1,6-dimethyl-4-N-(4-methylsulfanylphenyl)pyridin-1-ium-2,4-diamine iodide |
| PubChem CID | 139687678 |
| Molecular Formula | C14H18IN3S |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 1,6-dimethyl-4-N-(4-methylsulfanylphenyl)pyridin-1-ium-2,4-diamine iodide |
| SMILES | CSc1ccc(Nc2cc(C)[n+](C)c(N)c2)cc1.[I-] |
| InChI | InChI=1S/C14H17N3S.HI/c1-10-8-12(9-14(15)17(10)2)16-11-4-6-13(18-3)7-5-11;/h4-9H,1-3H3,(H2,15,16);1H |
| InChIKey | OUZCMKSGPLYIQS-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1,6-dimethyl-4-N-(4-methylsulfanylphenyl)pyridin-1-ium-2,4-diamine iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dimethyl-4-N-(4-methylsulfanylphenyl)pyridin-1-ium-2,4-diamine iodide?
The IUPAC name of 1,6-dimethyl-4-N-(4-methylsulfanylphenyl)pyridin-1-ium-2,4-diamine iodide (CID 139687678) is 1,6-dimethyl-4-N-(4-methylsulfanylphenyl)pyridin-1-ium-2,4-diamine iodide.
What is the SMILES notation for 1,6-dimethyl-4-N-(4-methylsulfanylphenyl)pyridin-1-ium-2,4-diamine iodide?
The canonical SMILES for 1,6-dimethyl-4-N-(4-methylsulfanylphenyl)pyridin-1-ium-2,4-diamine iodide is CSc1ccc(Nc2cc(C)[n+](C)c(N)c2)cc1.[I-].
What is the InChIKey of 1,6-dimethyl-4-N-(4-methylsulfanylphenyl)pyridin-1-ium-2,4-diamine iodide?
The InChIKey is OUZCMKSGPLYIQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3S.HI/c1-10-8-12(9-14(15)17(10)2)16-11-4-6-13(18-3)7-5-11;/h4-9H,1-3H3,(H2,15,16);1H.
What are the key properties of 1,6-dimethyl-4-N-(4-methylsulfanylphenyl)pyridin-1-ium-2,4-diamine iodide?
1,6-dimethyl-4-N-(4-methylsulfanylphenyl)pyridin-1-ium-2,4-diamine iodide has a molecular weight of 387.29 g/mol, XLogP of -0.13, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dimethyl-4-N-(4-methylsulfanylphenyl)pyridin-1-ium-2,4-diamine iodide is sourced from PubChem (CID 139687678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).