C29H30N6O4 — CID 139688088
(2S)-2-amino-N-[3-amino-5-[3-[4-(1-methylindol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]-2-oxopentyl]propanamide (PubChem CID 139688088) has the molecular formula C29H30N6O4 and a molecular weight of 526.60 g/mol. Its IUPAC name is (2S)-2-amino-N-[3-amino-5-[3-[4-(1-methylindol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]-2-oxopentyl]propanamide.
| Compound Name | (2S)-2-amino-N-[3-amino-5-[3-[4-(1-methylindol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]-2-oxopentyl]propanamide |
|---|---|
| PubChem CID | 139688088 |
| Molecular Formula | C29H30N6O4 |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | (2S)-2-amino-N-[3-amino-5-[3-[4-(1-methylindol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]-2-oxopentyl]propanamide |
| SMILES | C[C@H](N)C(=O)NCC(=O)C(N)CCn1cc(C2=C(c3cn(C)c4ccccc34)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C29H30N6O4/c1-16(30)27(37)32-13-24(36)21(31)11-12-35-15-20(18-8-4-6-10-23(18)35)26-25(28(38)33-29(26)39)19-14-34(2)22-9-5-3-7-17(19)22/h3-10,14-16,21H,11-13,30-31H2,1-2H3,(H,32,37)(H,33,38,39)/t16-,21?/m0/s1 |
| InChIKey | NOULWMNVXRLRRK-BJQOMGFOSA-N |
| XLogP | 1.45 |
| TPSA | 154.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|