C19H13ClN4 — CID 139688206
4-chloro-15-phenyl-13,14,16,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2(7),3,5,10,12,14-heptaene (PubChem CID 139688206) has the molecular formula C19H13ClN4 and a molecular weight of 332.79 g/mol. Its IUPAC name is 4-chloro-15-phenyl-13,14,16,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2(7),3,5,10,12,14-heptaene.
| Compound Name | 4-chloro-15-phenyl-13,14,16,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2(7),3,5,10,12,14-heptaene |
|---|---|
| PubChem CID | 139688206 |
| Molecular Formula | C19H13ClN4 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 4-chloro-15-phenyl-13,14,16,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2(7),3,5,10,12,14-heptaene |
| SMILES | Clc1ccc2c(c1)-c1nn3c(-c4ccccc4)nnc3cc1CC2 |
| InChI | InChI=1S/C19H13ClN4/c20-15-9-8-12-6-7-14-10-17-21-22-19(13-4-2-1-3-5-13)24(17)23-18(14)16(12)11-15/h1-5,8-11H,6-7H2 |
| InChIKey | ARVLGTUCARVENT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |