C18H13N5 — CID 139688243
15-pyridin-4-yl-13,14,16,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,12,14-heptaene (PubChem CID 139688243) has the molecular formula C18H13N5 and a molecular weight of 299.34 g/mol. Its IUPAC name is 15-pyridin-4-yl-13,14,16,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,12,14-heptaene.
| Compound Name | 15-pyridin-4-yl-13,14,16,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,12,14-heptaene |
|---|---|
| PubChem CID | 139688243 |
| Molecular Formula | C18H13N5 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 15-pyridin-4-yl-13,14,16,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,12,14-heptaene |
| SMILES | c1ccc2c(c1)CCc1cc3nnc(-c4ccncc4)n3nc1-2 |
| InChI | InChI=1S/C18H13N5/c1-2-4-15-12(3-1)5-6-14-11-16-20-21-18(23(16)22-17(14)15)13-7-9-19-10-8-13/h1-4,7-11H,5-6H2 |
| InChIKey | IXGCNCKONZNFMR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |