C13H26NNaO3S — CID 139688433
sodium 3-(dipentylamino)prop-2-ene-1-sulfonate (PubChem CID 139688433) has the molecular formula C13H26NNaO3S and a molecular weight of 299.41 g/mol. Its IUPAC name is sodium 3-(dipentylamino)prop-2-ene-1-sulfonate.
| Compound Name | sodium 3-(dipentylamino)prop-2-ene-1-sulfonate |
|---|---|
| PubChem CID | 139688433 |
| Molecular Formula | C13H26NNaO3S |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | sodium 3-(dipentylamino)prop-2-ene-1-sulfonate |
| SMILES | CCCCCN(C=CCS(=O)(=O)[O-])CCCCC.[Na+] |
| InChI | InChI=1S/C13H27NO3S.Na/c1-3-5-7-10-14(11-8-6-4-2)12-9-13-18(15,16)17;/h9,12H,3-8,10-11,13H2,1-2H3,(H,15,16,17);/q;+1/p-1 |
| InChIKey | SRQPSORQIRWTLM-UHFFFAOYSA-M |
| XLogP | -0.27 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|