About 4-oxohex-5-enoyl 4-oxohex-5-enoate
4-oxohex-5-enoyl 4-oxohex-5-enoate (PubChem CID 139688825) has the molecular formula C12H14O5
and a molecular weight of 238.24 g/mol. Its IUPAC name is 4-oxohex-5-enoyl 4-oxohex-5-enoate.
Molecular Properties
| Compound Name | 4-oxohex-5-enoyl 4-oxohex-5-enoate |
| PubChem CID | 139688825 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 4-oxohex-5-enoyl 4-oxohex-5-enoate |
| SMILES | C=CC(=O)CCC(=O)OC(=O)CCC(=O)C=C |
| InChI | InChI=1S/C12H14O5/c1-3-9(13)5-7-11(15)17-12(16)8-6-10(14)4-2/h3-4H,1-2,5-8H2 |
| InChIKey | UHNCEUWDGXDLGP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-oxohex-5-enoyl 4-oxohex-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxohex-5-enoyl 4-oxohex-5-enoate?
The IUPAC name of 4-oxohex-5-enoyl 4-oxohex-5-enoate (CID 139688825) is 4-oxohex-5-enoyl 4-oxohex-5-enoate.
What is the SMILES notation for 4-oxohex-5-enoyl 4-oxohex-5-enoate?
The canonical SMILES for 4-oxohex-5-enoyl 4-oxohex-5-enoate is C=CC(=O)CCC(=O)OC(=O)CCC(=O)C=C.
What is the InChIKey of 4-oxohex-5-enoyl 4-oxohex-5-enoate?
The InChIKey is UHNCEUWDGXDLGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O5/c1-3-9(13)5-7-11(15)17-12(16)8-6-10(14)4-2/h3-4H,1-2,5-8H2.
What are the key properties of 4-oxohex-5-enoyl 4-oxohex-5-enoate?
4-oxohex-5-enoyl 4-oxohex-5-enoate has a molecular weight of 238.24 g/mol, XLogP of 1.13, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxohex-5-enoyl 4-oxohex-5-enoate is sourced from PubChem (CID 139688825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).