About ethyl 2-[2,4-difluoro-5-(2-methylpropanoylamino)phenyl]sulfanylbutanoate
ethyl 2-[2,4-difluoro-5-(2-methylpropanoylamino)phenyl]sulfanylbutanoate (PubChem CID 139689423) has the molecular formula C16H21F2NO3S
and a molecular weight of 345.41 g/mol. Its IUPAC name is ethyl 2-[2,4-difluoro-5-(2-methylpropanoylamino)phenyl]sulfanylbutanoate.
Molecular Properties
| Compound Name | ethyl 2-[2,4-difluoro-5-(2-methylpropanoylamino)phenyl]sulfanylbutanoate |
| PubChem CID | 139689423 |
| Molecular Formula | C16H21F2NO3S |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | ethyl 2-[2,4-difluoro-5-(2-methylpropanoylamino)phenyl]sulfanylbutanoate |
| SMILES | CCOC(=O)C(CC)Sc1cc(NC(=O)C(C)C)c(F)cc1F |
| InChI | InChI=1S/C16H21F2NO3S/c1-5-13(16(21)22-6-2)23-14-8-12(10(17)7-11(14)18)19-15(20)9(3)4/h7-9,13H,5-6H2,1-4H3,(H,19,20) |
| InChIKey | IJDLOEVOSRUMNY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-[2,4-difluoro-5-(2-methylpropanoylamino)phenyl]sulfanylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2,4-difluoro-5-(2-methylpropanoylamino)phenyl]sulfanylbutanoate?
The IUPAC name of ethyl 2-[2,4-difluoro-5-(2-methylpropanoylamino)phenyl]sulfanylbutanoate (CID 139689423) is ethyl 2-[2,4-difluoro-5-(2-methylpropanoylamino)phenyl]sulfanylbutanoate.
What is the SMILES notation for ethyl 2-[2,4-difluoro-5-(2-methylpropanoylamino)phenyl]sulfanylbutanoate?
The canonical SMILES for ethyl 2-[2,4-difluoro-5-(2-methylpropanoylamino)phenyl]sulfanylbutanoate is CCOC(=O)C(CC)Sc1cc(NC(=O)C(C)C)c(F)cc1F.
What is the InChIKey of ethyl 2-[2,4-difluoro-5-(2-methylpropanoylamino)phenyl]sulfanylbutanoate?
The InChIKey is IJDLOEVOSRUMNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21F2NO3S/c1-5-13(16(21)22-6-2)23-14-8-12(10(17)7-11(14)18)19-15(20)9(3)4/h7-9,13H,5-6H2,1-4H3,(H,19,20).
What are the key properties of ethyl 2-[2,4-difluoro-5-(2-methylpropanoylamino)phenyl]sulfanylbutanoate?
ethyl 2-[2,4-difluoro-5-(2-methylpropanoylamino)phenyl]sulfanylbutanoate has a molecular weight of 345.41 g/mol, XLogP of 3.99, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2,4-difluoro-5-(2-methylpropanoylamino)phenyl]sulfanylbutanoate is sourced from PubChem (CID 139689423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).