C19H19F2NO3S — CID 139689424
propyl 2-(5-benzamido-2,4-difluorophenyl)sulfanylpropanoate (PubChem CID 139689424) has the molecular formula C19H19F2NO3S and a molecular weight of 379.43 g/mol. Its IUPAC name is propyl 2-(5-benzamido-2,4-difluorophenyl)sulfanylpropanoate.
| Compound Name | propyl 2-(5-benzamido-2,4-difluorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 139689424 |
| Molecular Formula | C19H19F2NO3S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | propyl 2-(5-benzamido-2,4-difluorophenyl)sulfanylpropanoate |
| SMILES | CCCOC(=O)C(C)Sc1cc(NC(=O)c2ccccc2)c(F)cc1F |
| InChI | InChI=1S/C19H19F2NO3S/c1-3-9-25-19(24)12(2)26-17-11-16(14(20)10-15(17)21)22-18(23)13-7-5-4-6-8-13/h4-8,10-12H,3,9H2,1-2H3,(H,22,23) |
| InChIKey | ZBUWBMQNHGOBRG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |