C17H23ClFNO3S — CID 139689436
butyl 2-(5-acetamido-2-chloro-4-fluorophenyl)sulfanylpentanoate (PubChem CID 139689436) has the molecular formula C17H23ClFNO3S and a molecular weight of 375.89 g/mol. Its IUPAC name is butyl 2-(5-acetamido-2-chloro-4-fluorophenyl)sulfanylpentanoate.
| Compound Name | butyl 2-(5-acetamido-2-chloro-4-fluorophenyl)sulfanylpentanoate |
|---|---|
| PubChem CID | 139689436 |
| Molecular Formula | C17H23ClFNO3S |
| Molecular Weight | 375.89 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | butyl 2-(5-acetamido-2-chloro-4-fluorophenyl)sulfanylpentanoate |
| SMILES | CCCCOC(=O)C(CCC)Sc1cc(NC(C)=O)c(F)cc1Cl |
| InChI | InChI=1S/C17H23ClFNO3S/c1-4-6-8-23-17(22)15(7-5-2)24-16-10-14(20-11(3)21)13(19)9-12(16)18/h9-10,15H,4-8H2,1-3H3,(H,20,21) |
| InChIKey | LNJQNQTWXOMMGE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.89 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|