C19H27F2NO3S — CID 139689511
butyl 2-[2,4-difluoro-5-(2-methylpropanoylamino)phenyl]sulfanyl-3-methylbutanoate (PubChem CID 139689511) has the molecular formula C19H27F2NO3S and a molecular weight of 387.49 g/mol. Its IUPAC name is butyl 2-[2,4-difluoro-5-(2-methylpropanoylamino)phenyl]sulfanyl-3-methylbutanoate.
| Compound Name | butyl 2-[2,4-difluoro-5-(2-methylpropanoylamino)phenyl]sulfanyl-3-methylbutanoate |
|---|---|
| PubChem CID | 139689511 |
| Molecular Formula | C19H27F2NO3S |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | butyl 2-[2,4-difluoro-5-(2-methylpropanoylamino)phenyl]sulfanyl-3-methylbutanoate |
| SMILES | CCCCOC(=O)C(Sc1cc(NC(=O)C(C)C)c(F)cc1F)C(C)C |
| InChI | InChI=1S/C19H27F2NO3S/c1-6-7-8-25-19(24)17(11(2)3)26-16-10-15(13(20)9-14(16)21)22-18(23)12(4)5/h9-12,17H,6-8H2,1-5H3,(H,22,23) |
| InChIKey | QVPVHXVGOZCLGM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|