C17H23ClFNO3S — CID 139690069
tert-butyl 2-[2-chloro-4-fluoro-5-(propanoylamino)phenyl]sulfanylbutanoate (PubChem CID 139690069) has the molecular formula C17H23ClFNO3S and a molecular weight of 375.89 g/mol. Its IUPAC name is tert-butyl 2-[2-chloro-4-fluoro-5-(propanoylamino)phenyl]sulfanylbutanoate.
| Compound Name | tert-butyl 2-[2-chloro-4-fluoro-5-(propanoylamino)phenyl]sulfanylbutanoate |
|---|---|
| PubChem CID | 139690069 |
| Molecular Formula | C17H23ClFNO3S |
| Molecular Weight | 375.89 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | tert-butyl 2-[2-chloro-4-fluoro-5-(propanoylamino)phenyl]sulfanylbutanoate |
| SMILES | CCC(=O)Nc1cc(SC(CC)C(=O)OC(C)(C)C)c(Cl)cc1F |
| InChI | InChI=1S/C17H23ClFNO3S/c1-6-13(16(22)23-17(3,4)5)24-14-9-12(20-15(21)7-2)11(19)8-10(14)18/h8-9,13H,6-7H2,1-5H3,(H,20,21) |
| InChIKey | LMLWWCYZBMGUIV-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.89 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |