C23H40O5Si — CID 139690354
ethyl (2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[(1R)-2-oxocyclopentyl]methyl]-3-(3-oxoprop-1-en-2-yl)hexanoate (PubChem CID 139690354) has the molecular formula C23H40O5Si and a molecular weight of 424.65 g/mol. Its IUPAC name is ethyl (2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[(1R)-2-oxocyclopentyl]methyl]-3-(3-oxoprop-1-en-2-yl)hexanoate.
| Compound Name | ethyl (2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[(1R)-2-oxocyclopentyl]methyl]-3-(3-oxoprop-1-en-2-yl)hexanoate |
|---|---|
| PubChem CID | 139690354 |
| Molecular Formula | C23H40O5Si |
| Molecular Weight | 424.65 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | ethyl (2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[(1R)-2-oxocyclopentyl]methyl]-3-(3-oxoprop-1-en-2-yl)hexanoate |
| SMILES | C=C(C=O)[C@H]([C@@H](CC)O[Si](C)(C)C(C)(C)C)[C@@H](C[C@H]1CCCC1=O)C(=O)OCC |
| InChI | InChI=1S/C23H40O5Si/c1-9-20(28-29(7,8)23(4,5)6)21(16(3)15-24)18(22(26)27-10-2)14-17-12-11-13-19(17)25/h15,17-18,20-21H,3,9-14H2,1-2,4-8H3/t17-,18-,20-,21+/m1/s1 |
| InChIKey | SYFPBZPJBBKXBQ-UKAVVXHISA-N |
| XLogP | 5.10 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.65 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|