C28H29F3O4S — CID 139690800
(2S,3S,4R,5S,6R)-2-methylsulfanyl-3,4,5-tris(phenylmethoxy)-6-(trifluoromethyl)oxane (PubChem CID 139690800) has the molecular formula C28H29F3O4S and a molecular weight of 518.60 g/mol. Its IUPAC name is (2S,3S,4R,5S,6R)-2-methylsulfanyl-3,4,5-tris(phenylmethoxy)-6-(trifluoromethyl)oxane.
| Compound Name | (2S,3S,4R,5S,6R)-2-methylsulfanyl-3,4,5-tris(phenylmethoxy)-6-(trifluoromethyl)oxane |
|---|---|
| PubChem CID | 139690800 |
| Molecular Formula | C28H29F3O4S |
| Molecular Weight | 518.60 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | (2S,3S,4R,5S,6R)-2-methylsulfanyl-3,4,5-tris(phenylmethoxy)-6-(trifluoromethyl)oxane |
| SMILES | CS[C@@H]1O[C@@H](C(F)(F)F)[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H29F3O4S/c1-36-27-25(34-19-22-15-9-4-10-16-22)23(32-17-20-11-5-2-6-12-20)24(26(35-27)28(29,30)31)33-18-21-13-7-3-8-14-21/h2-16,23-27H,17-19H2,1H3/t23-,24+,25+,26-,27+/m1/s1 |
| InChIKey | ZCZSOOIRWDVFGB-KQZFZZGISA-N |
| XLogP | 6.39 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.60 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |