About tert-butyl-(3,3-dimethylbutyl)-diethoxygermane
tert-butyl-(3,3-dimethylbutyl)-diethoxygermane (PubChem CID 139690894) has the molecular formula C14H32GeO2
and a molecular weight of 305.02 g/mol. Its IUPAC name is tert-butyl-(3,3-dimethylbutyl)-diethoxygermane.
Molecular Properties
| Compound Name | tert-butyl-(3,3-dimethylbutyl)-diethoxygermane |
| PubChem CID | 139690894 |
| Molecular Formula | C14H32GeO2 |
| Molecular Weight | 305.02 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | tert-butyl-(3,3-dimethylbutyl)-diethoxygermane |
| SMILES | CCO[Ge](CCC(C)(C)C)(OCC)C(C)(C)C |
| InChI | InChI=1S/C14H32GeO2/c1-9-16-15(17-10-2,14(6,7)8)12-11-13(3,4)5/h9-12H2,1-8H3 |
| InChIKey | SPFLUHJMYRCUCA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.02 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butyl-(3,3-dimethylbutyl)-diethoxygermane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-(3,3-dimethylbutyl)-diethoxygermane?
The IUPAC name of tert-butyl-(3,3-dimethylbutyl)-diethoxygermane (CID 139690894) is tert-butyl-(3,3-dimethylbutyl)-diethoxygermane.
What is the SMILES notation for tert-butyl-(3,3-dimethylbutyl)-diethoxygermane?
The canonical SMILES for tert-butyl-(3,3-dimethylbutyl)-diethoxygermane is CCO[Ge](CCC(C)(C)C)(OCC)C(C)(C)C.
What is the InChIKey of tert-butyl-(3,3-dimethylbutyl)-diethoxygermane?
The InChIKey is SPFLUHJMYRCUCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H32GeO2/c1-9-16-15(17-10-2,14(6,7)8)12-11-13(3,4)5/h9-12H2,1-8H3.
What are the key properties of tert-butyl-(3,3-dimethylbutyl)-diethoxygermane?
tert-butyl-(3,3-dimethylbutyl)-diethoxygermane has a molecular weight of 305.02 g/mol, XLogP of 4.74, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-(3,3-dimethylbutyl)-diethoxygermane is sourced from PubChem (CID 139690894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).