About [1,3]dioxolo[4,5-g][1,3]benzothiazole
[1,3]dioxolo[4,5-g][1,3]benzothiazole (PubChem CID 139691081) has the molecular formula C8H5NO2S
and a molecular weight of 179.20 g/mol. Its IUPAC name is [1,3]dioxolo[4,5-g][1,3]benzothiazole.
Molecular Properties
| Compound Name | [1,3]dioxolo[4,5-g][1,3]benzothiazole |
| PubChem CID | 139691081 |
| Molecular Formula | C8H5NO2S |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.00 |
| IUPAC Name | [1,3]dioxolo[4,5-g][1,3]benzothiazole |
| SMILES | c1nc2ccc3c(c2s1)OCO3 |
| InChI | InChI=1S/C8H5NO2S/c1-2-6-7(11-4-10-6)8-5(1)9-3-12-8/h1-3H,4H2 |
| InChIKey | SOLMCBVQLTZNML-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1,3]dioxolo[4,5-g][1,3]benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3]dioxolo[4,5-g][1,3]benzothiazole?
The IUPAC name of [1,3]dioxolo[4,5-g][1,3]benzothiazole (CID 139691081) is [1,3]dioxolo[4,5-g][1,3]benzothiazole.
What is the SMILES notation for [1,3]dioxolo[4,5-g][1,3]benzothiazole?
The canonical SMILES for [1,3]dioxolo[4,5-g][1,3]benzothiazole is c1nc2ccc3c(c2s1)OCO3.
What is the InChIKey of [1,3]dioxolo[4,5-g][1,3]benzothiazole?
The InChIKey is SOLMCBVQLTZNML-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO2S/c1-2-6-7(11-4-10-6)8-5(1)9-3-12-8/h1-3H,4H2.
What are the key properties of [1,3]dioxolo[4,5-g][1,3]benzothiazole?
[1,3]dioxolo[4,5-g][1,3]benzothiazole has a molecular weight of 179.20 g/mol, XLogP of 2.03, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3]dioxolo[4,5-g][1,3]benzothiazole is sourced from PubChem (CID 139691081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).