C8H5NO2S — CID 139691081
[1,3]dioxolo[4,5-g][1,3]benzothiazole (PubChem CID 139691081) has the molecular formula C8H5NO2S and a molecular weight of 179.20 g/mol. Its IUPAC name is [1,3]dioxolo[4,5-g][1,3]benzothiazole.
| Compound Name | [1,3]dioxolo[4,5-g][1,3]benzothiazole |
|---|---|
| PubChem CID | 139691081 |
| Molecular Formula | C8H5NO2S |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.00 |
| IUPAC Name | [1,3]dioxolo[4,5-g][1,3]benzothiazole |
| SMILES | c1nc2ccc3c(c2s1)OCO3 |
| InChI | InChI=1S/C8H5NO2S/c1-2-6-7(11-4-10-6)8-5(1)9-3-12-8/h1-3H,4H2 |
| InChIKey | SOLMCBVQLTZNML-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |