C20H21NO5S2 — CID 139691957
5-[[4-[3-(4-methylphenyl)sulfonylpropoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 139691957) has the molecular formula C20H21NO5S2 and a molecular weight of 419.52 g/mol. Its IUPAC name is 5-[[4-[3-(4-methylphenyl)sulfonylpropoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[3-(4-methylphenyl)sulfonylpropoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 139691957 |
| Molecular Formula | C20H21NO5S2 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 5-[[4-[3-(4-methylphenyl)sulfonylpropoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(S(=O)(=O)CCCOc2ccc(CC3SC(=O)NC3=O)cc2)cc1 |
| InChI | InChI=1S/C20H21NO5S2/c1-14-3-9-17(10-4-14)28(24,25)12-2-11-26-16-7-5-15(6-8-16)13-18-19(22)21-20(23)27-18/h3-10,18H,2,11-13H2,1H3,(H,21,22,23) |
| InChIKey | QFNAXCBBUZUFQS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|