C9H16N2OS2Si — CID 139692465
(7aR)-3-methyl-5-sulfanylidene-6-trimethylsilyl-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazol-7-one (PubChem CID 139692465) has the molecular formula C9H16N2OS2Si and a molecular weight of 260.46 g/mol. Its IUPAC name is (7aR)-3-methyl-5-sulfanylidene-6-trimethylsilyl-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazol-7-one.
| Compound Name | (7aR)-3-methyl-5-sulfanylidene-6-trimethylsilyl-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazol-7-one |
|---|---|
| PubChem CID | 139692465 |
| Molecular Formula | C9H16N2OS2Si |
| Molecular Weight | 260.46 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | (7aR)-3-methyl-5-sulfanylidene-6-trimethylsilyl-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazol-7-one |
| SMILES | CC1SC[C@H]2C(=O)N([Si](C)(C)C)C(=S)N12 |
| InChI | InChI=1S/C9H16N2OS2Si/c1-6-10-7(5-14-6)8(12)11(9(10)13)15(2,3)4/h6-7H,5H2,1-4H3/t6?,7-/m0/s1 |
| InChIKey | JXFHZMZOXQEMEV-MLWJPKLSSA-N |
| XLogP | 1.71 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.46 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|