C27H29Br2N7O4 — CID 139693066
(2R)-2-[(4-amino-3,5-dibromophenyl)methyl-(2,2-diphenylacetyl)amino]-5-[(N'-nitrocarbamimidoyl)amino]pentanamide (PubChem CID 139693066) has the molecular formula C27H29Br2N7O4 and a molecular weight of 675.38 g/mol. Its IUPAC name is (2R)-2-[(4-amino-3,5-dibromophenyl)methyl-(2,2-diphenylacetyl)amino]-5-[(N'-nitrocarbamimidoyl)amino]pentanamide.
| Compound Name | (2R)-2-[(4-amino-3,5-dibromophenyl)methyl-(2,2-diphenylacetyl)amino]-5-[(N'-nitrocarbamimidoyl)amino]pentanamide |
|---|---|
| PubChem CID | 139693066 |
| Molecular Formula | C27H29Br2N7O4 |
| Molecular Weight | 675.38 g/mol |
| Exact Mass | 673.06 |
| IUPAC Name | (2R)-2-[(4-amino-3,5-dibromophenyl)methyl-(2,2-diphenylacetyl)amino]-5-[(N'-nitrocarbamimidoyl)amino]pentanamide |
| SMILES | NC(=O)[C@@H](CCCNC(N)=N[N+](=O)[O-])N(Cc1cc(Br)c(N)c(Br)c1)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H29Br2N7O4/c28-20-14-17(15-21(29)24(20)30)16-35(22(25(31)37)12-7-13-33-27(32)34-36(39)40)26(38)23(18-8-3-1-4-9-18)19-10-5-2-6-11-19/h1-6,8-11,14-15,22-23H,7,12-13,16,30H2,(H2,31,37)(H3,32,33,34)/t22-/m1/s1 |
| InChIKey | FOOZWGCPULDAMU-JOCHJYFZSA-N |
| XLogP | 3.68 |
| TPSA | 182.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|