About methyl 2-octyl-2,3-dihydro-1-benzofuran-5-carboxylate
methyl 2-octyl-2,3-dihydro-1-benzofuran-5-carboxylate (PubChem CID 139693266) has the molecular formula C18H26O3
and a molecular weight of 290.40 g/mol. Its IUPAC name is methyl 2-octyl-2,3-dihydro-1-benzofuran-5-carboxylate.
Molecular Properties
| Compound Name | methyl 2-octyl-2,3-dihydro-1-benzofuran-5-carboxylate |
| PubChem CID | 139693266 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | methyl 2-octyl-2,3-dihydro-1-benzofuran-5-carboxylate |
| SMILES | CCCCCCCCC1Cc2cc(C(=O)OC)ccc2O1 |
| InChI | InChI=1S/C18H26O3/c1-3-4-5-6-7-8-9-16-13-15-12-14(18(19)20-2)10-11-17(15)21-16/h10-12,16H,3-9,13H2,1-2H3 |
| InChIKey | YFBDXKIGOXFJDH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-octyl-2,3-dihydro-1-benzofuran-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-octyl-2,3-dihydro-1-benzofuran-5-carboxylate?
The IUPAC name of methyl 2-octyl-2,3-dihydro-1-benzofuran-5-carboxylate (CID 139693266) is methyl 2-octyl-2,3-dihydro-1-benzofuran-5-carboxylate.
What is the SMILES notation for methyl 2-octyl-2,3-dihydro-1-benzofuran-5-carboxylate?
The canonical SMILES for methyl 2-octyl-2,3-dihydro-1-benzofuran-5-carboxylate is CCCCCCCCC1Cc2cc(C(=O)OC)ccc2O1.
What is the InChIKey of methyl 2-octyl-2,3-dihydro-1-benzofuran-5-carboxylate?
The InChIKey is YFBDXKIGOXFJDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O3/c1-3-4-5-6-7-8-9-16-13-15-12-14(18(19)20-2)10-11-17(15)21-16/h10-12,16H,3-9,13H2,1-2H3.
What are the key properties of methyl 2-octyl-2,3-dihydro-1-benzofuran-5-carboxylate?
methyl 2-octyl-2,3-dihydro-1-benzofuran-5-carboxylate has a molecular weight of 290.40 g/mol, XLogP of 4.53, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-octyl-2,3-dihydro-1-benzofuran-5-carboxylate is sourced from PubChem (CID 139693266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).