About 4,5-dichloro-3,6-bis(2-methoxyethoxy)benzene-1,2-dicarbonitrile
4,5-dichloro-3,6-bis(2-methoxyethoxy)benzene-1,2-dicarbonitrile (PubChem CID 139694402) has the molecular formula C14H14Cl2N2O4
and a molecular weight of 345.18 g/mol. Its IUPAC name is 4,5-dichloro-3,6-bis(2-methoxyethoxy)benzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4,5-dichloro-3,6-bis(2-methoxyethoxy)benzene-1,2-dicarbonitrile |
| PubChem CID | 139694402 |
| Molecular Formula | C14H14Cl2N2O4 |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 4,5-dichloro-3,6-bis(2-methoxyethoxy)benzene-1,2-dicarbonitrile |
| SMILES | COCCOc1c(Cl)c(Cl)c(OCCOC)c(C#N)c1C#N |
| InChI | InChI=1S/C14H14Cl2N2O4/c1-19-3-5-21-13-9(7-17)10(8-18)14(12(16)11(13)15)22-6-4-20-2/h3-6H2,1-2H3 |
| InChIKey | JBMDECLSWOOTGX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 84.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dichloro-3,6-bis(2-methoxyethoxy)benzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-3,6-bis(2-methoxyethoxy)benzene-1,2-dicarbonitrile?
The IUPAC name of 4,5-dichloro-3,6-bis(2-methoxyethoxy)benzene-1,2-dicarbonitrile (CID 139694402) is 4,5-dichloro-3,6-bis(2-methoxyethoxy)benzene-1,2-dicarbonitrile.
What is the SMILES notation for 4,5-dichloro-3,6-bis(2-methoxyethoxy)benzene-1,2-dicarbonitrile?
The canonical SMILES for 4,5-dichloro-3,6-bis(2-methoxyethoxy)benzene-1,2-dicarbonitrile is COCCOc1c(Cl)c(Cl)c(OCCOC)c(C#N)c1C#N.
What is the InChIKey of 4,5-dichloro-3,6-bis(2-methoxyethoxy)benzene-1,2-dicarbonitrile?
The InChIKey is JBMDECLSWOOTGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14Cl2N2O4/c1-19-3-5-21-13-9(7-17)10(8-18)14(12(16)11(13)15)22-6-4-20-2/h3-6H2,1-2H3.
What are the key properties of 4,5-dichloro-3,6-bis(2-methoxyethoxy)benzene-1,2-dicarbonitrile?
4,5-dichloro-3,6-bis(2-methoxyethoxy)benzene-1,2-dicarbonitrile has a molecular weight of 345.18 g/mol, XLogP of 2.79, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-3,6-bis(2-methoxyethoxy)benzene-1,2-dicarbonitrile is sourced from PubChem (CID 139694402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).