About 2,2-dibromo-N'-methyl-N-[(4-methyloxolan-3-yl)methyl]-2-nitroethanimidamide
2,2-dibromo-N'-methyl-N-[(4-methyloxolan-3-yl)methyl]-2-nitroethanimidamide (PubChem CID 139694520) has the molecular formula C9H15Br2N3O3
and a molecular weight of 373.05 g/mol. Its IUPAC name is 2,2-dibromo-N'-methyl-N-[(4-methyloxolan-3-yl)methyl]-2-nitroethanimidamide.
Molecular Properties
| Compound Name | 2,2-dibromo-N'-methyl-N-[(4-methyloxolan-3-yl)methyl]-2-nitroethanimidamide |
| PubChem CID | 139694520 |
| Molecular Formula | C9H15Br2N3O3 |
| Molecular Weight | 373.05 g/mol |
| Exact Mass | 370.95 |
| IUPAC Name | 2,2-dibromo-N'-methyl-N-[(4-methyloxolan-3-yl)methyl]-2-nitroethanimidamide |
| SMILES | C/N=C(\NCC1COCC1C)C(Br)(Br)[N+](=O)[O-] |
| InChI | InChI=1S/C9H15Br2N3O3/c1-6-4-17-5-7(6)3-13-8(12-2)9(10,11)14(15)16/h6-7H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | QLNJIOZDOYIJFE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.05 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dibromo-N'-methyl-N-[(4-methyloxolan-3-yl)methyl]-2-nitroethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dibromo-N'-methyl-N-[(4-methyloxolan-3-yl)methyl]-2-nitroethanimidamide?
The IUPAC name of 2,2-dibromo-N'-methyl-N-[(4-methyloxolan-3-yl)methyl]-2-nitroethanimidamide (CID 139694520) is 2,2-dibromo-N'-methyl-N-[(4-methyloxolan-3-yl)methyl]-2-nitroethanimidamide.
What is the SMILES notation for 2,2-dibromo-N'-methyl-N-[(4-methyloxolan-3-yl)methyl]-2-nitroethanimidamide?
The canonical SMILES for 2,2-dibromo-N'-methyl-N-[(4-methyloxolan-3-yl)methyl]-2-nitroethanimidamide is C/N=C(\NCC1COCC1C)C(Br)(Br)[N+](=O)[O-].
What is the InChIKey of 2,2-dibromo-N'-methyl-N-[(4-methyloxolan-3-yl)methyl]-2-nitroethanimidamide?
The InChIKey is QLNJIOZDOYIJFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15Br2N3O3/c1-6-4-17-5-7(6)3-13-8(12-2)9(10,11)14(15)16/h6-7H,3-5H2,1-2H3,(H,12,13).
What are the key properties of 2,2-dibromo-N'-methyl-N-[(4-methyloxolan-3-yl)methyl]-2-nitroethanimidamide?
2,2-dibromo-N'-methyl-N-[(4-methyloxolan-3-yl)methyl]-2-nitroethanimidamide has a molecular weight of 373.05 g/mol, XLogP of 1.61, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dibromo-N'-methyl-N-[(4-methyloxolan-3-yl)methyl]-2-nitroethanimidamide is sourced from PubChem (CID 139694520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).