About 2,2-dibromo-N-ethyl-2-nitro-N'-(oxolan-3-ylmethyl)ethanimidamide
2,2-dibromo-N-ethyl-2-nitro-N'-(oxolan-3-ylmethyl)ethanimidamide (PubChem CID 139694571) has the molecular formula C9H15Br2N3O3
and a molecular weight of 373.05 g/mol. Its IUPAC name is 2,2-dibromo-N-ethyl-2-nitro-N'-(oxolan-3-ylmethyl)ethanimidamide.
Molecular Properties
| Compound Name | 2,2-dibromo-N-ethyl-2-nitro-N'-(oxolan-3-ylmethyl)ethanimidamide |
| PubChem CID | 139694571 |
| Molecular Formula | C9H15Br2N3O3 |
| Molecular Weight | 373.05 g/mol |
| Exact Mass | 370.95 |
| IUPAC Name | 2,2-dibromo-N-ethyl-2-nitro-N'-(oxolan-3-ylmethyl)ethanimidamide |
| SMILES | CCN/C(=N\CC1CCOC1)C(Br)(Br)[N+](=O)[O-] |
| InChI | InChI=1S/C9H15Br2N3O3/c1-2-12-8(9(10,11)14(15)16)13-5-7-3-4-17-6-7/h7H,2-6H2,1H3,(H,12,13) |
| InChIKey | CANCQQHOHZRUKK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.05 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dibromo-N-ethyl-2-nitro-N'-(oxolan-3-ylmethyl)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dibromo-N-ethyl-2-nitro-N'-(oxolan-3-ylmethyl)ethanimidamide?
The IUPAC name of 2,2-dibromo-N-ethyl-2-nitro-N'-(oxolan-3-ylmethyl)ethanimidamide (CID 139694571) is 2,2-dibromo-N-ethyl-2-nitro-N'-(oxolan-3-ylmethyl)ethanimidamide.
What is the SMILES notation for 2,2-dibromo-N-ethyl-2-nitro-N'-(oxolan-3-ylmethyl)ethanimidamide?
The canonical SMILES for 2,2-dibromo-N-ethyl-2-nitro-N'-(oxolan-3-ylmethyl)ethanimidamide is CCN/C(=N\CC1CCOC1)C(Br)(Br)[N+](=O)[O-].
What is the InChIKey of 2,2-dibromo-N-ethyl-2-nitro-N'-(oxolan-3-ylmethyl)ethanimidamide?
The InChIKey is CANCQQHOHZRUKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15Br2N3O3/c1-2-12-8(9(10,11)14(15)16)13-5-7-3-4-17-6-7/h7H,2-6H2,1H3,(H,12,13).
What are the key properties of 2,2-dibromo-N-ethyl-2-nitro-N'-(oxolan-3-ylmethyl)ethanimidamide?
2,2-dibromo-N-ethyl-2-nitro-N'-(oxolan-3-ylmethyl)ethanimidamide has a molecular weight of 373.05 g/mol, XLogP of 1.75, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dibromo-N-ethyl-2-nitro-N'-(oxolan-3-ylmethyl)ethanimidamide is sourced from PubChem (CID 139694571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).