C18H27N7OS — CID 139694724
N-[[2-[2-[(N'-hexylcarbamimidoyl)amino]-1,3-thiazol-4-yl]pyrimidin-4-yl]methyl]propanamide (PubChem CID 139694724) has the molecular formula C18H27N7OS and a molecular weight of 389.53 g/mol. Its IUPAC name is N-[[2-[2-[(N'-hexylcarbamimidoyl)amino]-1,3-thiazol-4-yl]pyrimidin-4-yl]methyl]propanamide.
| Compound Name | N-[[2-[2-[(N'-hexylcarbamimidoyl)amino]-1,3-thiazol-4-yl]pyrimidin-4-yl]methyl]propanamide |
|---|---|
| PubChem CID | 139694724 |
| Molecular Formula | C18H27N7OS |
| Molecular Weight | 389.53 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | N-[[2-[2-[(N'-hexylcarbamimidoyl)amino]-1,3-thiazol-4-yl]pyrimidin-4-yl]methyl]propanamide |
| SMILES | CCCCCC/N=C(\N)Nc1nc(-c2nccc(CNC(=O)CC)n2)cs1 |
| InChI | InChI=1S/C18H27N7OS/c1-3-5-6-7-9-21-17(19)25-18-24-14(12-27-18)16-20-10-8-13(23-16)11-22-15(26)4-2/h8,10,12H,3-7,9,11H2,1-2H3,(H,22,26)(H3,19,21,24,25) |
| InChIKey | WQGFADIDSJWTBM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 118.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.53 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|