C17H25N7OS — CID 139694731
N-[[2-[2-[(N'-pentylcarbamimidoyl)amino]-1,3-thiazol-4-yl]pyrimidin-4-yl]methyl]propanamide (PubChem CID 139694731) has the molecular formula C17H25N7OS and a molecular weight of 375.50 g/mol. Its IUPAC name is N-[[2-[2-[(N'-pentylcarbamimidoyl)amino]-1,3-thiazol-4-yl]pyrimidin-4-yl]methyl]propanamide.
| Compound Name | N-[[2-[2-[(N'-pentylcarbamimidoyl)amino]-1,3-thiazol-4-yl]pyrimidin-4-yl]methyl]propanamide |
|---|---|
| PubChem CID | 139694731 |
| Molecular Formula | C17H25N7OS |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | N-[[2-[2-[(N'-pentylcarbamimidoyl)amino]-1,3-thiazol-4-yl]pyrimidin-4-yl]methyl]propanamide |
| SMILES | CCCCC/N=C(\N)Nc1nc(-c2nccc(CNC(=O)CC)n2)cs1 |
| InChI | InChI=1S/C17H25N7OS/c1-3-5-6-8-20-16(18)24-17-23-13(11-26-17)15-19-9-7-12(22-15)10-21-14(25)4-2/h7,9,11H,3-6,8,10H2,1-2H3,(H,21,25)(H3,18,20,23,24) |
| InChIKey | RRUHGXACJKARPV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 118.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|