C16H15ClN2O — CID 139695635
2-[1-(4-chloro-2-methylphenoxy)ethyl]-1H-benzimidazole (PubChem CID 139695635) has the molecular formula C16H15ClN2O and a molecular weight of 286.76 g/mol. Its IUPAC name is 2-[1-(4-chloro-2-methylphenoxy)ethyl]-1H-benzimidazole.
| Compound Name | 2-[1-(4-chloro-2-methylphenoxy)ethyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 139695635 |
| Molecular Formula | C16H15ClN2O |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 2-[1-(4-chloro-2-methylphenoxy)ethyl]-1H-benzimidazole |
| SMILES | Cc1cc(Cl)ccc1OC(C)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H15ClN2O/c1-10-9-12(17)7-8-15(10)20-11(2)16-18-13-5-3-4-6-14(13)19-16/h3-9,11H,1-2H3,(H,18,19) |
| InChIKey | YYEZHCPJZJCLHZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |