C41H39FN4OSi — CID 139695694
2-[[3-(4-fluorophenyl)-4-(3-tritylbenzimidazol-5-yl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 139695694) has the molecular formula C41H39FN4OSi and a molecular weight of 650.87 g/mol. Its IUPAC name is 2-[[3-(4-fluorophenyl)-4-(3-tritylbenzimidazol-5-yl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-(4-fluorophenyl)-4-(3-tritylbenzimidazol-5-yl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 139695694 |
| Molecular Formula | C41H39FN4OSi |
| Molecular Weight | 650.87 g/mol |
| Exact Mass | 650.29 |
| IUPAC Name | 2-[[3-(4-fluorophenyl)-4-(3-tritylbenzimidazol-5-yl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2ccc3ncn(C(c4ccccc4)(c4ccccc4)c4ccccc4)c3c2)c(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C41H39FN4OSi/c1-48(2,3)26-25-47-30-45-28-37(40(44-45)31-19-22-36(42)23-20-31)32-21-24-38-39(27-32)46(29-43-38)41(33-13-7-4-8-14-33,34-15-9-5-10-16-34)35-17-11-6-12-18-35/h4-24,27-29H,25-26,30H2,1-3H3 |
| InChIKey | CSMLBWRKTYLBKD-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.87 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|