About 2-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-5-methylbenzenethiol
2-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-5-methylbenzenethiol (PubChem CID 139696816) has the molecular formula C26H24BrPS
and a molecular weight of 479.42 g/mol. Its IUPAC name is 2-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-5-methylbenzenethiol.
Molecular Properties
| Compound Name | 2-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-5-methylbenzenethiol |
| PubChem CID | 139696816 |
| Molecular Formula | C26H24BrPS |
| Molecular Weight | 479.42 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | 2-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-5-methylbenzenethiol |
| SMILES | Cc1ccc(CP(Br)(c2ccccc2)(c2ccccc2)c2ccccc2)c(S)c1 |
| InChI | InChI=1S/C26H24BrPS/c1-21-17-18-22(26(29)19-21)20-28(27,23-11-5-2-6-12-23,24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2-19,29H,20H2,1H3 |
| InChIKey | LWSVJBNHXPHUGR-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.42 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-5-methylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-5-methylbenzenethiol?
The IUPAC name of 2-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-5-methylbenzenethiol (CID 139696816) is 2-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-5-methylbenzenethiol.
What is the SMILES notation for 2-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-5-methylbenzenethiol?
The canonical SMILES for 2-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-5-methylbenzenethiol is Cc1ccc(CP(Br)(c2ccccc2)(c2ccccc2)c2ccccc2)c(S)c1.
What is the InChIKey of 2-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-5-methylbenzenethiol?
The InChIKey is LWSVJBNHXPHUGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24BrPS/c1-21-17-18-22(26(29)19-21)20-28(27,23-11-5-2-6-12-23,24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2-19,29H,20H2,1H3.
What are the key properties of 2-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-5-methylbenzenethiol?
2-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-5-methylbenzenethiol has a molecular weight of 479.42 g/mol, XLogP of 6.62, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-5-methylbenzenethiol is sourced from PubChem (CID 139696816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).