About N-(2,3-dihydroxypropyl)-4,5-dihydroxy-N-(1-hydroxy-3-methoxypropyl)pentanamide
N-(2,3-dihydroxypropyl)-4,5-dihydroxy-N-(1-hydroxy-3-methoxypropyl)pentanamide (PubChem CID 139697255) has the molecular formula C12H25NO7
and a molecular weight of 295.33 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-4,5-dihydroxy-N-(1-hydroxy-3-methoxypropyl)pentanamide.
Molecular Properties
| Compound Name | N-(2,3-dihydroxypropyl)-4,5-dihydroxy-N-(1-hydroxy-3-methoxypropyl)pentanamide |
| PubChem CID | 139697255 |
| Molecular Formula | C12H25NO7 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-4,5-dihydroxy-N-(1-hydroxy-3-methoxypropyl)pentanamide |
| SMILES | COCCC(O)N(CC(O)CO)C(=O)CCC(O)CO |
| InChI | InChI=1S/C12H25NO7/c1-20-5-4-12(19)13(6-10(17)8-15)11(18)3-2-9(16)7-14/h9-10,12,14-17,19H,2-8H2,1H3 |
| InChIKey | LWDDVZIPDCNHEI-UHFFFAOYSA-N |
| XLogP | -2.34 |
| TPSA | 130.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(2,3-dihydroxypropyl)-4,5-dihydroxy-N-(1-hydroxy-3-methoxypropyl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dihydroxypropyl)-4,5-dihydroxy-N-(1-hydroxy-3-methoxypropyl)pentanamide?
The IUPAC name of N-(2,3-dihydroxypropyl)-4,5-dihydroxy-N-(1-hydroxy-3-methoxypropyl)pentanamide (CID 139697255) is N-(2,3-dihydroxypropyl)-4,5-dihydroxy-N-(1-hydroxy-3-methoxypropyl)pentanamide.
What is the SMILES notation for N-(2,3-dihydroxypropyl)-4,5-dihydroxy-N-(1-hydroxy-3-methoxypropyl)pentanamide?
The canonical SMILES for N-(2,3-dihydroxypropyl)-4,5-dihydroxy-N-(1-hydroxy-3-methoxypropyl)pentanamide is COCCC(O)N(CC(O)CO)C(=O)CCC(O)CO.
What is the InChIKey of N-(2,3-dihydroxypropyl)-4,5-dihydroxy-N-(1-hydroxy-3-methoxypropyl)pentanamide?
The InChIKey is LWDDVZIPDCNHEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO7/c1-20-5-4-12(19)13(6-10(17)8-15)11(18)3-2-9(16)7-14/h9-10,12,14-17,19H,2-8H2,1H3.
What are the key properties of N-(2,3-dihydroxypropyl)-4,5-dihydroxy-N-(1-hydroxy-3-methoxypropyl)pentanamide?
N-(2,3-dihydroxypropyl)-4,5-dihydroxy-N-(1-hydroxy-3-methoxypropyl)pentanamide has a molecular weight of 295.33 g/mol, XLogP of -2.34, 11 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dihydroxypropyl)-4,5-dihydroxy-N-(1-hydroxy-3-methoxypropyl)pentanamide is sourced from PubChem (CID 139697255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).