C12H7F5N4S — CID 139697499
5-amino-4-(1,1,2,2,2-pentafluoroethylsulfanyl)-1-phenylpyrazole-3-carbonitrile (PubChem CID 139697499) has the molecular formula C12H7F5N4S and a molecular weight of 334.27 g/mol. Its IUPAC name is 5-amino-4-(1,1,2,2,2-pentafluoroethylsulfanyl)-1-phenylpyrazole-3-carbonitrile.
| Compound Name | 5-amino-4-(1,1,2,2,2-pentafluoroethylsulfanyl)-1-phenylpyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 139697499 |
| Molecular Formula | C12H7F5N4S |
| Molecular Weight | 334.27 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 5-amino-4-(1,1,2,2,2-pentafluoroethylsulfanyl)-1-phenylpyrazole-3-carbonitrile |
| SMILES | N#Cc1nn(-c2ccccc2)c(N)c1SC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H7F5N4S/c13-11(14,15)12(16,17)22-9-8(6-18)20-21(10(9)19)7-4-2-1-3-5-7/h1-5H,19H2 |
| InChIKey | NZNWVKGXDSRDSI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.27 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|