C69H78F6O10 — CID 139697980
bis[4-[4-(4-octoxyphenyl)phenoxy]carbonylphenyl] (2S,12S)-2,12-bis(trifluoromethyl)tridecanedioate (PubChem CID 139697980) has the molecular formula C69H78F6O10 and a molecular weight of 1181.36 g/mol. Its IUPAC name is bis[4-[4-(4-octoxyphenyl)phenoxy]carbonylphenyl] (2S,12S)-2,12-bis(trifluoromethyl)tridecanedioate.
| Compound Name | bis[4-[4-(4-octoxyphenyl)phenoxy]carbonylphenyl] (2S,12S)-2,12-bis(trifluoromethyl)tridecanedioate |
|---|---|
| PubChem CID | 139697980 |
| Molecular Formula | C69H78F6O10 |
| Molecular Weight | 1181.36 g/mol |
| Exact Mass | 1180.55 |
| IUPAC Name | bis[4-[4-(4-octoxyphenyl)phenoxy]carbonylphenyl] (2S,12S)-2,12-bis(trifluoromethyl)tridecanedioate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(OC(=O)c3ccc(OC(=O)[C@H](CCCCCCCCC[C@@H](C(=O)Oc4ccc(C(=O)Oc5ccc(-c6ccc(OCCCCCCCC)cc6)cc5)cc4)C(F)(F)F)C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C69H78F6O10/c1-3-5-7-9-16-20-48-80-56-36-24-50(25-37-56)52-28-40-58(41-29-52)82-64(76)54-32-44-60(45-33-54)84-66(78)62(68(70,71)72)22-18-14-12-11-13-15-19-23-63(69(73,74)75)67(79)85-61-46-34-55(35-47-61)65(77)83-59-42-30-53(31-43-59)51-26-38-57(39-27-51)81-49-21-17-10-8-6-4-2/h24-47,62-63H,3-23,48-49H2,1-2H3/t62-,63-/m0/s1 |
| InChIKey | OHVBITYQMKDGTA-NTGUUYCISA-N |
| XLogP | 19.32 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1181.36 |
| LogP ≤ 5 | 19.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|