C68H76F6O10 — CID 139697991
bis[4-[4-(4-octoxyphenyl)phenoxy]carbonylphenyl] (2S,11S)-2,11-bis(trifluoromethyl)dodecanedioate (PubChem CID 139697991) has the molecular formula C68H76F6O10 and a molecular weight of 1167.33 g/mol. Its IUPAC name is bis[4-[4-(4-octoxyphenyl)phenoxy]carbonylphenyl] (2S,11S)-2,11-bis(trifluoromethyl)dodecanedioate.
| Compound Name | bis[4-[4-(4-octoxyphenyl)phenoxy]carbonylphenyl] (2S,11S)-2,11-bis(trifluoromethyl)dodecanedioate |
|---|---|
| PubChem CID | 139697991 |
| Molecular Formula | C68H76F6O10 |
| Molecular Weight | 1167.33 g/mol |
| Exact Mass | 1166.53 |
| IUPAC Name | bis[4-[4-(4-octoxyphenyl)phenoxy]carbonylphenyl] (2S,11S)-2,11-bis(trifluoromethyl)dodecanedioate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(OC(=O)c3ccc(OC(=O)[C@H](CCCCCCCC[C@@H](C(=O)Oc4ccc(C(=O)Oc5ccc(-c6ccc(OCCCCCCCC)cc6)cc5)cc4)C(F)(F)F)C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C68H76F6O10/c1-3-5-7-9-15-19-47-79-55-35-23-49(24-36-55)51-27-39-57(40-28-51)81-63(75)53-31-43-59(44-32-53)83-65(77)61(67(69,70)71)21-17-13-11-12-14-18-22-62(68(72,73)74)66(78)84-60-45-33-54(34-46-60)64(76)82-58-41-29-52(30-42-58)50-25-37-56(38-26-50)80-48-20-16-10-8-6-4-2/h23-46,61-62H,3-22,47-48H2,1-2H3/t61-,62-/m0/s1 |
| InChIKey | QKVWCFXJXJLXCG-TVHLTLAGSA-N |
| XLogP | 18.93 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1167.33 |
| LogP ≤ 5 | 18.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|