C34H68N6 — CID 139699004
N,N'-bis[1-(2,2,6,6-tetramethylpiperidin-4-yl)piperidin-4-yl]hexane-1,6-diamine (PubChem CID 139699004) has the molecular formula C34H68N6 and a molecular weight of 560.96 g/mol. Its IUPAC name is N,N'-bis[1-(2,2,6,6-tetramethylpiperidin-4-yl)piperidin-4-yl]hexane-1,6-diamine.
| Compound Name | N,N'-bis[1-(2,2,6,6-tetramethylpiperidin-4-yl)piperidin-4-yl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 139699004 |
| Molecular Formula | C34H68N6 |
| Molecular Weight | 560.96 g/mol |
| Exact Mass | 560.55 |
| IUPAC Name | N,N'-bis[1-(2,2,6,6-tetramethylpiperidin-4-yl)piperidin-4-yl]hexane-1,6-diamine |
| SMILES | CC1(C)CC(N2CCC(NCCCCCCNC3CCN(C4CC(C)(C)NC(C)(C)C4)CC3)CC2)CC(C)(C)N1 |
| InChI | InChI=1S/C34H68N6/c1-31(2)23-29(24-32(3,4)37-31)39-19-13-27(14-20-39)35-17-11-9-10-12-18-36-28-15-21-40(22-16-28)30-25-33(5,6)38-34(7,8)26-30/h27-30,35-38H,9-26H2,1-8H3 |
| InChIKey | MTUDOEKGRCEPHC-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.96 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|