C12H22O3Si — CID 139699575
trimethoxy-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 139699575) has the molecular formula C12H22O3Si and a molecular weight of 242.39 g/mol. Its IUPAC name is trimethoxy-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | trimethoxy-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 139699575 |
| Molecular Formula | C12H22O3Si |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | trimethoxy-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CO[Si](OC)(OC)C1(C)C=C(C)C(C)=C1C |
| InChI | InChI=1S/C12H22O3Si/c1-9-8-12(4,11(3)10(9)2)16(13-5,14-6)15-7/h8H,1-7H3 |
| InChIKey | NLWBGUIJBGZMKI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|