C8H8F8O2 — CID 139700115
1,1,5,5,6,7,7,7-octafluoro-2-hydroxy-2-methylheptan-3-one (PubChem CID 139700115) has the molecular formula C8H8F8O2 and a molecular weight of 288.13 g/mol. Its IUPAC name is 1,1,5,5,6,7,7,7-octafluoro-2-hydroxy-2-methylheptan-3-one.
| Compound Name | 1,1,5,5,6,7,7,7-octafluoro-2-hydroxy-2-methylheptan-3-one |
|---|---|
| PubChem CID | 139700115 |
| Molecular Formula | C8H8F8O2 |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 1,1,5,5,6,7,7,7-octafluoro-2-hydroxy-2-methylheptan-3-one |
| SMILES | CC(O)(C(=O)CC(F)(F)C(F)C(F)(F)F)C(F)F |
| InChI | InChI=1S/C8H8F8O2/c1-6(18,5(10)11)3(17)2-7(12,13)4(9)8(14,15)16/h4-5,18H,2H2,1H3 |
| InChIKey | FYCSZXIWJGJGRT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |