C28H39N3O2SSi — CID 139701910
[(2S,4R)-1-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]-(3-methyl-2-phenylsulfanylimidazol-4-yl)methanol (PubChem CID 139701910) has the molecular formula C28H39N3O2SSi and a molecular weight of 509.79 g/mol. Its IUPAC name is [(2S,4R)-1-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]-(3-methyl-2-phenylsulfanylimidazol-4-yl)methanol.
| Compound Name | [(2S,4R)-1-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]-(3-methyl-2-phenylsulfanylimidazol-4-yl)methanol |
|---|---|
| PubChem CID | 139701910 |
| Molecular Formula | C28H39N3O2SSi |
| Molecular Weight | 509.79 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | [(2S,4R)-1-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]-(3-methyl-2-phenylsulfanylimidazol-4-yl)methanol |
| SMILES | Cn1c(C(O)[C@@H]2C[C@@H](O[Si](C)(C)C(C)(C)C)CN2Cc2ccccc2)cnc1Sc1ccccc1 |
| InChI | InChI=1S/C28H39N3O2SSi/c1-28(2,3)35(5,6)33-22-17-24(31(20-22)19-21-13-9-7-10-14-21)26(32)25-18-29-27(30(25)4)34-23-15-11-8-12-16-23/h7-16,18,22,24,26,32H,17,19-20H2,1-6H3/t22-,24+,26?/m1/s1 |
| InChIKey | FBSSJKCVZCIKDI-SAUVGFCRSA-N |
| XLogP | 6.27 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.79 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|