C19H16Cl2FN2+ — CID 1397021
1-[(2,4-dichlorophenyl)methyl]-3-(4-fluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium (PubChem CID 1397021) has the molecular formula C19H16Cl2FN2+ and a molecular weight of 362.26 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-3-(4-fluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-3-(4-fluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium |
|---|---|
| PubChem CID | 1397021 |
| Molecular Formula | C19H16Cl2FN2+ |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-3-(4-fluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium |
| SMILES | Fc1ccc(-c2c[n+](Cc3ccc(Cl)cc3Cl)c3n2CCC3)cc1 |
| InChI | InChI=1S/C19H16Cl2FN2/c20-15-6-3-14(17(21)10-15)11-23-12-18(24-9-1-2-19(23)24)13-4-7-16(22)8-5-13/h3-8,10,12H,1-2,9,11H2/q+1 |
| InChIKey | UITNDLUCARTXSV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|